C15H14FNO2 — CID 64793447
2-(3-fluorophenyl)-N-(3-hydroxy-2-methylphenyl)acetamide (PubChem CID 64793447) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-(3-hydroxy-2-methylphenyl)acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-(3-hydroxy-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 64793447 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-(3-fluorophenyl)-N-(3-hydroxy-2-methylphenyl)acetamide |
| SMILES | Cc1c(O)cccc1NC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H14FNO2/c1-10-13(6-3-7-14(10)18)17-15(19)9-11-4-2-5-12(16)8-11/h2-8,18H,9H2,1H3,(H,17,19) |
| InChIKey | OJLWIROSXHAUTI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |