C33H61NO7 — CID 6479515
1-[[(E)-octadec-9-enyl]amino]-3-[[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol (PubChem CID 6479515) has the molecular formula C33H61NO7 and a molecular weight of 583.85 g/mol. Its IUPAC name is 1-[[(E)-octadec-9-enyl]amino]-3-[[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol.
| Compound Name | 1-[[(E)-octadec-9-enyl]amino]-3-[[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol |
|---|---|
| PubChem CID | 6479515 |
| Molecular Formula | C33H61NO7 |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.44 |
| IUPAC Name | 1-[[(E)-octadec-9-enyl]amino]-3-[[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]propan-2-ol |
| SMILES | CCCCCCCC/C=C/CCCCCCCCNCC(O)COCC1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C33H61NO7/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-34-23-26(35)24-36-25-27-28-29(39-32(2,3)38-28)30-31(37-27)41-33(4,5)40-30/h13-14,26-31,34-35H,6-12,15-25H2,1-5H3/b14-13+/t26?,27?,28-,29-,30+,31+/m0/s1 |
| InChIKey | FAKLUGTWBJINDJ-JFNKNXABSA-N |
| XLogP | 6.39 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|