About 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide
1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide (PubChem CID 647954) has the molecular formula C16H16N2O4S2
and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide |
| PubChem CID | 647954 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NC1CCSC1=O)c1cccc(C(=O)NC2CCSC2=O)c1 |
| InChI | InChI=1S/C16H16N2O4S2/c19-13(17-11-4-6-23-15(11)21)9-2-1-3-10(8-9)14(20)18-12-5-7-24-16(12)22/h1-3,8,11-12H,4-7H2,(H,17,19)(H,18,20) |
| InChIKey | WQKGXFYNDRMLLF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide?
The IUPAC name of 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide (CID 647954) is 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide.
What is the SMILES notation for 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide?
The canonical SMILES for 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide is O=C(NC1CCSC1=O)c1cccc(C(=O)NC2CCSC2=O)c1.
What is the InChIKey of 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide?
The InChIKey is WQKGXFYNDRMLLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4S2/c19-13(17-11-4-6-23-15(11)21)9-2-1-3-10(8-9)14(20)18-12-5-7-24-16(12)22/h1-3,8,11-12H,4-7H2,(H,17,19)(H,18,20).
What are the key properties of 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide?
1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide has a molecular weight of 364.45 g/mol, XLogP of 1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis(2-oxothiolan-3-yl)benzene-1,3-dicarboxamide is sourced from PubChem (CID 647954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).