C16H35N3O — CID 64795994
5-[4-(dimethylamino)piperidin-1-yl]-2-methyl-2-(propan-2-ylamino)pentan-1-ol (PubChem CID 64795994) has the molecular formula C16H35N3O and a molecular weight of 285.48 g/mol. Its IUPAC name is 5-[4-(dimethylamino)piperidin-1-yl]-2-methyl-2-(propan-2-ylamino)pentan-1-ol.
| Compound Name | 5-[4-(dimethylamino)piperidin-1-yl]-2-methyl-2-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64795994 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | 5-[4-(dimethylamino)piperidin-1-yl]-2-methyl-2-(propan-2-ylamino)pentan-1-ol |
| SMILES | CC(C)NC(C)(CO)CCCN1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C16H35N3O/c1-14(2)17-16(3,13-20)9-6-10-19-11-7-15(8-12-19)18(4)5/h14-15,17,20H,6-13H2,1-5H3 |
| InChIKey | PZAVUNVBXQOTKV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |