C29H19ClN2O3 — CID 6479608
4-[[5-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]naphthalen-2-yl]carbamoyl]benzoic acid (PubChem CID 6479608) has the molecular formula C29H19ClN2O3 and a molecular weight of 478.94 g/mol. Its IUPAC name is 4-[[5-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]naphthalen-2-yl]carbamoyl]benzoic acid.
| Compound Name | 4-[[5-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]naphthalen-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 6479608 |
| Molecular Formula | C29H19ClN2O3 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 4-[[5-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]naphthalen-2-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)Nc2ccc3c(/C=C/c4ccc5ccc(Cl)cc5n4)cccc3c2)cc1 |
| InChI | InChI=1S/C29H19ClN2O3/c30-23-11-8-19-10-13-24(31-27(19)17-23)12-9-18-2-1-3-22-16-25(14-15-26(18)22)32-28(33)20-4-6-21(7-5-20)29(34)35/h1-17H,(H,32,33)(H,34,35)/b12-9+ |
| InChIKey | UMXMZMCABWCYMJ-FMIVXFBMSA-N |
| XLogP | 7.16 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |