C29H24F3NO5S2 — CID 6479790
2-[(5Z)-4-oxo-5-[[4-[(2S)-2-phenylpropoxy]-3-[(1S)-2,2,2-trifluoro-1-phenylethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 6479790) has the molecular formula C29H24F3NO5S2 and a molecular weight of 587.64 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-5-[[4-[(2S)-2-phenylpropoxy]-3-[(1S)-2,2,2-trifluoro-1-phenylethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-4-oxo-5-[[4-[(2S)-2-phenylpropoxy]-3-[(1S)-2,2,2-trifluoro-1-phenylethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 6479790 |
| Molecular Formula | C29H24F3NO5S2 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | 2-[(5Z)-4-oxo-5-[[4-[(2S)-2-phenylpropoxy]-3-[(1S)-2,2,2-trifluoro-1-phenylethoxy]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | C[C@H](COc1ccc(/C=C2\SC(=S)N(CC(=O)O)C2=O)cc1O[C@@H](c1ccccc1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C29H24F3NO5S2/c1-18(20-8-4-2-5-9-20)17-37-22-13-12-19(15-24-27(36)33(16-25(34)35)28(39)40-24)14-23(22)38-26(29(30,31)32)21-10-6-3-7-11-21/h2-15,18,26H,16-17H2,1H3,(H,34,35)/b24-15-/t18-,26+/m1/s1 |
| InChIKey | LHYRKNFTTKMDNQ-WQFLCVAXSA-N |
| XLogP | 6.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|