C13H26N2O2 — CID 64798204
2-cyclopropyl-3-morpholin-4-yl-2-(propan-2-ylamino)propan-1-ol (PubChem CID 64798204) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-cyclopropyl-3-morpholin-4-yl-2-(propan-2-ylamino)propan-1-ol.
| Compound Name | 2-cyclopropyl-3-morpholin-4-yl-2-(propan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 64798204 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-cyclopropyl-3-morpholin-4-yl-2-(propan-2-ylamino)propan-1-ol |
| SMILES | CC(C)NC(CO)(CN1CCOCC1)C1CC1 |
| InChI | InChI=1S/C13H26N2O2/c1-11(2)14-13(10-16,12-3-4-12)9-15-5-7-17-8-6-15/h11-12,14,16H,3-10H2,1-2H3 |
| InChIKey | XXGKVTKSRLHQIM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |