C29H42O6 — CID 6479922
[(2R)-2-[(2E,6E)-3-(acetyloxymethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]-5-oxo-2H-furan-3-yl]methyl acetate (PubChem CID 6479922) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is [(2R)-2-[(2E,6E)-3-(acetyloxymethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]-5-oxo-2H-furan-3-yl]methyl acetate.
| Compound Name | [(2R)-2-[(2E,6E)-3-(acetyloxymethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]-5-oxo-2H-furan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 6479922 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | [(2R)-2-[(2E,6E)-3-(acetyloxymethyl)-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl]-5-oxo-2H-furan-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC(=O)O[C@@H]1C/C=C(\CC/C=C(\C)CCC1=C(C)CCCC1(C)C)COC(C)=O |
| InChI | InChI=1S/C29H42O6/c1-20(12-14-26-21(2)10-8-16-29(26,5)6)9-7-11-24(18-33-22(3)30)13-15-27-25(17-28(32)35-27)19-34-23(4)31/h9,13,17,27H,7-8,10-12,14-16,18-19H2,1-6H3/b20-9+,24-13+/t27-/m1/s1 |
| InChIKey | HUOUTXIIOOBRPE-IITVDRRISA-N |
| XLogP | 6.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|