About N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine
N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 64799289) has the molecular formula C11H16F3N3
and a molecular weight of 247.26 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine |
| PubChem CID | 64799289 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | FC(F)(F)CNCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C11H16F3N3/c12-11(13,14)8-15-7-9-5-6-17(16-9)10-3-1-2-4-10/h5-6,10,15H,1-4,7-8H2 |
| InChIKey | UOUGNGZLHSYENI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine?
The IUPAC name of N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine (CID 64799289) is N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine.
What is the SMILES notation for N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine?
The canonical SMILES for N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine is FC(F)(F)CNCc1ccn(C2CCCC2)n1.
What is the InChIKey of N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine?
The InChIKey is UOUGNGZLHSYENI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3/c12-11(13,14)8-15-7-9-5-6-17(16-9)10-3-1-2-4-10/h5-6,10,15H,1-4,7-8H2.
What are the key properties of N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine?
N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine has a molecular weight of 247.26 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-cyclopentylpyrazol-3-yl)methyl]-2,2,2-trifluoroethanamine is sourced from PubChem (CID 64799289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).