About [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid
[(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid (PubChem CID 6480061) has the molecular formula C8H15N4O6P
and a molecular weight of 294.20 g/mol. Its IUPAC name is [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
Molecular Properties
| Compound Name | [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| PubChem CID | 6480061 |
| Molecular Formula | C8H15N4O6P |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid |
| SMILES | Nc1cc(OC[C@@H](CO)OCP(=O)(O)O)nc(N)n1 |
| InChI | InChI=1S/C8H15N4O6P/c9-6-1-7(12-8(10)11-6)17-3-5(2-13)18-4-19(14,15)16/h1,5,13H,2-4H2,(H2,14,15,16)(H4,9,10,11,12)/t5-/m1/s1 |
| InChIKey | SDORNFBUOMQVCA-RXMQYKEDSA-N |
| XLogP | -1.47 |
| TPSA | 174.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The IUPAC name of [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid (CID 6480061) is [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid.
What is the SMILES notation for [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The canonical SMILES for [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid is Nc1cc(OC[C@@H](CO)OCP(=O)(O)O)nc(N)n1.
What is the InChIKey of [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
The InChIKey is SDORNFBUOMQVCA-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H15N4O6P/c9-6-1-7(12-8(10)11-6)17-3-5(2-13)18-4-19(14,15)16/h1,5,13H,2-4H2,(H2,14,15,16)(H4,9,10,11,12)/t5-/m1/s1.
What are the key properties of [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid?
[(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid has a molecular weight of 294.20 g/mol, XLogP of -1.47, 7 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(2,6-diaminopyrimidin-4-yl)oxy-3-hydroxypropan-2-yl]oxymethylphosphonic acid is sourced from PubChem (CID 6480061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).