C14H25N3O2S — CID 64801230
1,1-dioxo-N-[(1-pentan-3-ylpyrazol-3-yl)methyl]thian-4-amine (PubChem CID 64801230) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1,1-dioxo-N-[(1-pentan-3-ylpyrazol-3-yl)methyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[(1-pentan-3-ylpyrazol-3-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 64801230 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1,1-dioxo-N-[(1-pentan-3-ylpyrazol-3-yl)methyl]thian-4-amine |
| SMILES | CCC(CC)n1ccc(CNC2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C14H25N3O2S/c1-3-14(4-2)17-8-5-13(16-17)11-15-12-6-9-20(18,19)10-7-12/h5,8,12,14-15H,3-4,6-7,9-11H2,1-2H3 |
| InChIKey | FXWDMTTVUSHQMN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |