C16H19N3OS — CID 64801308
4-[(1-cyclopentylpyrazol-3-yl)methoxy]benzenecarbothioamide (PubChem CID 64801308) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 4-[(1-cyclopentylpyrazol-3-yl)methoxy]benzenecarbothioamide.
| Compound Name | 4-[(1-cyclopentylpyrazol-3-yl)methoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 64801308 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-[(1-cyclopentylpyrazol-3-yl)methoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OCc2ccn(C3CCCC3)n2)cc1 |
| InChI | InChI=1S/C16H19N3OS/c17-16(21)12-5-7-15(8-6-12)20-11-13-9-10-19(18-13)14-3-1-2-4-14/h5-10,14H,1-4,11H2,(H2,17,21) |
| InChIKey | ZTIRZJGKXRZIRG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|