C12H24N4O2S — CID 64801421
N-[2-[(1-pentan-3-ylpyrazol-3-yl)methylamino]ethyl]methanesulfonamide (PubChem CID 64801421) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-[2-[(1-pentan-3-ylpyrazol-3-yl)methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(1-pentan-3-ylpyrazol-3-yl)methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 64801421 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[2-[(1-pentan-3-ylpyrazol-3-yl)methylamino]ethyl]methanesulfonamide |
| SMILES | CCC(CC)n1ccc(CNCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C12H24N4O2S/c1-4-12(5-2)16-9-6-11(15-16)10-13-7-8-14-19(3,17)18/h6,9,12-14H,4-5,7-8,10H2,1-3H3 |
| InChIKey | XGCPIMVENQADBB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|