C13H22N4 — CID 64801478
2-[(1-butan-2-ylpyrazol-3-yl)methyl-propylamino]acetonitrile (PubChem CID 64801478) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-[(1-butan-2-ylpyrazol-3-yl)methyl-propylamino]acetonitrile.
| Compound Name | 2-[(1-butan-2-ylpyrazol-3-yl)methyl-propylamino]acetonitrile |
|---|---|
| PubChem CID | 64801478 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-[(1-butan-2-ylpyrazol-3-yl)methyl-propylamino]acetonitrile |
| SMILES | CCCN(CC#N)Cc1ccn(C(C)CC)n1 |
| InChI | InChI=1S/C13H22N4/c1-4-8-16(10-7-14)11-13-6-9-17(15-13)12(3)5-2/h6,9,12H,4-5,8,10-11H2,1-3H3 |
| InChIKey | CKHKLKSDTKZGSA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|