C25H28N2O3 — CID 6480197
6-[(3,5-dimethylphenyl)methyl]-5-ethyl-1-[[(E)-3-phenylprop-2-enoxy]methyl]pyrimidine-2,4-dione (PubChem CID 6480197) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 6-[(3,5-dimethylphenyl)methyl]-5-ethyl-1-[[(E)-3-phenylprop-2-enoxy]methyl]pyrimidine-2,4-dione.
| Compound Name | 6-[(3,5-dimethylphenyl)methyl]-5-ethyl-1-[[(E)-3-phenylprop-2-enoxy]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6480197 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 6-[(3,5-dimethylphenyl)methyl]-5-ethyl-1-[[(E)-3-phenylprop-2-enoxy]methyl]pyrimidine-2,4-dione |
| SMILES | CCc1c(Cc2cc(C)cc(C)c2)n(COC/C=C/c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H28N2O3/c1-4-22-23(16-21-14-18(2)13-19(3)15-21)27(25(29)26-24(22)28)17-30-12-8-11-20-9-6-5-7-10-20/h5-11,13-15H,4,12,16-17H2,1-3H3,(H,26,28,29)/b11-8+ |
| InChIKey | MWKVXKKXNPMFNN-DHZHZOJOSA-N |
| XLogP | 3.99 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|