C25H40O2 — CID 6480208
(1R,3S,4S,6R,7R,8E,11S,12S,13S,16S)-8-(hydroxymethyl)-1,4,16-trimethyl-13-prop-1-en-2-yltetracyclo[9.7.0.03,7.012,16]octadec-8-en-6-ol (PubChem CID 6480208) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (1R,3S,4S,6R,7R,8E,11S,12S,13S,16S)-8-(hydroxymethyl)-1,4,16-trimethyl-13-prop-1-en-2-yltetracyclo[9.7.0.03,7.012,16]octadec-8-en-6-ol.
| Compound Name | (1R,3S,4S,6R,7R,8E,11S,12S,13S,16S)-8-(hydroxymethyl)-1,4,16-trimethyl-13-prop-1-en-2-yltetracyclo[9.7.0.03,7.012,16]octadec-8-en-6-ol |
|---|---|
| PubChem CID | 6480208 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (1R,3S,4S,6R,7R,8E,11S,12S,13S,16S)-8-(hydroxymethyl)-1,4,16-trimethyl-13-prop-1-en-2-yltetracyclo[9.7.0.03,7.012,16]octadec-8-en-6-ol |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)CC[C@]3(C)C[C@@H]4[C@H](/C(CO)=C\C[C@H]3[C@H]12)[C@H](O)C[C@@H]4C |
| InChI | InChI=1S/C25H40O2/c1-15(2)18-8-9-24(4)10-11-25(5)13-19-16(3)12-21(27)22(19)17(14-26)6-7-20(25)23(18)24/h6,16,18-23,26-27H,1,7-14H2,2-5H3/b17-6-/t16-,18+,19-,20-,21+,22-,23-,24-,25+/m0/s1 |
| InChIKey | GFUBBDUOFRQHPV-BJZYOKJQSA-N |
| XLogP | 5.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|