C22H36O4 — CID 6480216
[(1R,3aR,4E,6R,8E,10S,12S,12aS)-12-hydroxy-1-(2-hydroxypropan-2-yl)-3a,6,10-trimethyl-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-10-yl] acetate (PubChem CID 6480216) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(1R,3aR,4E,6R,8E,10S,12S,12aS)-12-hydroxy-1-(2-hydroxypropan-2-yl)-3a,6,10-trimethyl-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-10-yl] acetate.
| Compound Name | [(1R,3aR,4E,6R,8E,10S,12S,12aS)-12-hydroxy-1-(2-hydroxypropan-2-yl)-3a,6,10-trimethyl-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-10-yl] acetate |
|---|---|
| PubChem CID | 6480216 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(1R,3aR,4E,6R,8E,10S,12S,12aS)-12-hydroxy-1-(2-hydroxypropan-2-yl)-3a,6,10-trimethyl-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-10-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)/C=C/C[C@@H](C)/C=C/[C@@]2(C)CC[C@@H](C(C)(C)O)[C@@H]2[C@@H](O)C1 |
| InChI | InChI=1S/C22H36O4/c1-15-8-7-11-22(6,26-16(2)23)14-18(24)19-17(20(3,4)25)10-13-21(19,5)12-9-15/h7,9,11-12,15,17-19,24-25H,8,10,13-14H2,1-6H3/b11-7+,12-9+/t15-,17-,18+,19-,21+,22-/m1/s1 |
| InChIKey | HXNTUGGXVUBGMN-LWOYXUSCSA-N |
| XLogP | 4.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|