C15H31NO2 — CID 64802589
2-cyclopropyl-3-(4-methylpentan-2-yloxy)-2-(propylamino)propan-1-ol (PubChem CID 64802589) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-cyclopropyl-3-(4-methylpentan-2-yloxy)-2-(propylamino)propan-1-ol.
| Compound Name | 2-cyclopropyl-3-(4-methylpentan-2-yloxy)-2-(propylamino)propan-1-ol |
|---|---|
| PubChem CID | 64802589 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2-cyclopropyl-3-(4-methylpentan-2-yloxy)-2-(propylamino)propan-1-ol |
| SMILES | CCCNC(CO)(COC(C)CC(C)C)C1CC1 |
| InChI | InChI=1S/C15H31NO2/c1-5-8-16-15(10-17,14-6-7-14)11-18-13(4)9-12(2)3/h12-14,16-17H,5-11H2,1-4H3 |
| InChIKey | HLOVYEZPSWGGIP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |