C30H36N6O2 — CID 6480506
ethyl N-[8-[4-(diethylamino)butylamino]-2,3-diphenylpyrido[2,3-b]pyrazin-6-yl]carbamate (PubChem CID 6480506) has the molecular formula C30H36N6O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is ethyl N-[8-[4-(diethylamino)butylamino]-2,3-diphenylpyrido[2,3-b]pyrazin-6-yl]carbamate.
| Compound Name | ethyl N-[8-[4-(diethylamino)butylamino]-2,3-diphenylpyrido[2,3-b]pyrazin-6-yl]carbamate |
|---|---|
| PubChem CID | 6480506 |
| Molecular Formula | C30H36N6O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | ethyl N-[8-[4-(diethylamino)butylamino]-2,3-diphenylpyrido[2,3-b]pyrazin-6-yl]carbamate |
| SMILES | CCOC(=O)Nc1cc(NCCCCN(CC)CC)c2nc(-c3ccccc3)c(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C30H36N6O2/c1-4-36(5-2)20-14-13-19-31-24-21-25(33-30(37)38-6-3)32-29-28(24)34-26(22-15-9-7-10-16-22)27(35-29)23-17-11-8-12-18-23/h7-12,15-18,21H,4-6,13-14,19-20H2,1-3H3,(H2,31,32,33,35,37) |
| InChIKey | JAMASXYVIJBNCE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|