About (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine
(5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine (PubChem CID 6480529) has the molecular formula C20H38N2
and a molecular weight of 306.54 g/mol. Its IUPAC name is (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine.
Molecular Properties
| Compound Name | (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine |
| PubChem CID | 6480529 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine |
| SMILES | CC(C)=CCC/C(C)=C\CCC(C)NCCN1CCCCC1 |
| InChI | InChI=1S/C20H38N2/c1-18(2)10-8-11-19(3)12-9-13-20(4)21-14-17-22-15-6-5-7-16-22/h10,12,20-21H,5-9,11,13-17H2,1-4H3/b19-12- |
| InChIKey | SKIYCHPBLQZBBM-UNOMPAQXSA-N |
| XLogP | 4.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine?
The IUPAC name of (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine (CID 6480529) is (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine.
What is the SMILES notation for (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine?
The canonical SMILES for (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine is CC(C)=CCC/C(C)=C\CCC(C)NCCN1CCCCC1.
What is the InChIKey of (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine?
The InChIKey is SKIYCHPBLQZBBM-UNOMPAQXSA-N. The full InChI is InChI=1S/C20H38N2/c1-18(2)10-8-11-19(3)12-9-13-20(4)21-14-17-22-15-6-5-7-16-22/h10,12,20-21H,5-9,11,13-17H2,1-4H3/b19-12-.
What are the key properties of (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine?
(5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine has a molecular weight of 306.54 g/mol, XLogP of 4.92, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-6,10-dimethyl-N-(2-piperidin-1-ylethyl)undeca-5,9-dien-2-amine is sourced from PubChem (CID 6480529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).