About (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine
(5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine (PubChem CID 6480533) has the molecular formula C22H42N2
and a molecular weight of 334.59 g/mol. Its IUPAC name is (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine.
Molecular Properties
| Compound Name | (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine |
| PubChem CID | 6480533 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)NCCCN1CCCCC1C |
| InChI | InChI=1S/C22H42N2/c1-19(2)11-8-12-20(3)13-9-14-21(4)23-16-10-18-24-17-7-6-15-22(24)5/h11,13,21-23H,6-10,12,14-18H2,1-5H3/b20-13+ |
| InChIKey | FDQGRXRFBGNVSB-DEDYPNTBSA-N |
| XLogP | 5.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine?
The IUPAC name of (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine (CID 6480533) is (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine.
What is the SMILES notation for (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine?
The canonical SMILES for (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine is CC(C)=CCC/C(C)=C/CCC(C)NCCCN1CCCCC1C.
What is the InChIKey of (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine?
The InChIKey is FDQGRXRFBGNVSB-DEDYPNTBSA-N. The full InChI is InChI=1S/C22H42N2/c1-19(2)11-8-12-20(3)13-9-14-21(4)23-16-10-18-24-17-7-6-15-22(24)5/h11,13,21-23H,6-10,12,14-18H2,1-5H3/b20-13+.
What are the key properties of (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine?
(5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine has a molecular weight of 334.59 g/mol, XLogP of 5.70, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-6,10-dimethyl-N-[3-(2-methylpiperidin-1-yl)propyl]undeca-5,9-dien-2-amine is sourced from PubChem (CID 6480533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).