C24H48N2 — CID 6480535
N',N'-dibutyl-N-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]propane-1,3-diamine (PubChem CID 6480535) has the molecular formula C24H48N2 and a molecular weight of 364.66 g/mol. Its IUPAC name is N',N'-dibutyl-N-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 6480535 |
| Molecular Formula | C24H48N2 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.38 |
| IUPAC Name | N',N'-dibutyl-N-[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNC(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H48N2/c1-7-9-19-26(20-10-8-2)21-13-18-25-24(6)17-12-16-23(5)15-11-14-22(3)4/h14,16,24-25H,7-13,15,17-21H2,1-6H3/b23-16+ |
| InChIKey | BMWPDNPIIAFKJB-XQNSMLJCSA-N |
| XLogP | 6.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|