About 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol
6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol (PubChem CID 64805464) has the molecular formula C14H28N4OS2
and a molecular weight of 332.54 g/mol. Its IUPAC name is 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol.
Molecular Properties
| Compound Name | 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol |
| PubChem CID | 64805464 |
| Molecular Formula | C14H28N4OS2 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol |
| SMILES | CC(C)NC(C)(CO)CCCCSc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C14H28N4OS2/c1-11(2)15-14(3,10-19)8-6-7-9-20-13-17-16-12(21-13)18(4)5/h11,15,19H,6-10H2,1-5H3 |
| InChIKey | JKCWFHDUGUTPOD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol?
The IUPAC name of 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol (CID 64805464) is 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol.
What is the SMILES notation for 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol?
The canonical SMILES for 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol is CC(C)NC(C)(CO)CCCCSc1nnc(N(C)C)s1.
What is the InChIKey of 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol?
The InChIKey is JKCWFHDUGUTPOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4OS2/c1-11(2)15-14(3,10-19)8-6-7-9-20-13-17-16-12(21-13)18(4)5/h11,15,19H,6-10H2,1-5H3.
What are the key properties of 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol?
6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol has a molecular weight of 332.54 g/mol, XLogP of 2.62, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-2-methyl-2-(propan-2-ylamino)hexan-1-ol is sourced from PubChem (CID 64805464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).