C26H48N2 — CID 6480547
4-[[4-[[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]amino]cyclohexyl]methyl]cyclohexan-1-amine (PubChem CID 6480547) has the molecular formula C26H48N2 and a molecular weight of 388.68 g/mol. Its IUPAC name is 4-[[4-[[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]amino]cyclohexyl]methyl]cyclohexan-1-amine.
| Compound Name | 4-[[4-[[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]amino]cyclohexyl]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 6480547 |
| Molecular Formula | C26H48N2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.38 |
| IUPAC Name | 4-[[4-[[(5E)-6,10-dimethylundeca-5,9-dien-2-yl]amino]cyclohexyl]methyl]cyclohexan-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)NC1CCC(CC2CCC(N)CC2)CC1 |
| InChI | InChI=1S/C26H48N2/c1-20(2)7-5-8-21(3)9-6-10-22(4)28-26-17-13-24(14-18-26)19-23-11-15-25(27)16-12-23/h7,9,22-26,28H,5-6,8,10-19,27H2,1-4H3/b21-9+ |
| InChIKey | ZWXUAMJLMBOGHZ-ZVBGSRNCSA-N |
| XLogP | 6.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|