C15H26N4OS — CID 64805535
5-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)pentan-1-ol (PubChem CID 64805535) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 5-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)pentan-1-ol.
| Compound Name | 5-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64805535 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 5-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)pentan-1-ol |
| SMILES | CNC(C)(CO)CCCSc1nnc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C15H26N4OS/c1-15(10-20,16-2)8-3-9-21-14-18-17-13(11-4-5-11)19(14)12-6-7-12/h11-12,16,20H,3-10H2,1-2H3 |
| InChIKey | IYARGKBXIXWXEP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|