About (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine
(3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine (PubChem CID 6480554) has the molecular formula C17H34N2
and a molecular weight of 266.47 g/mol. Its IUPAC name is (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine.
Molecular Properties
| Compound Name | (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine |
| PubChem CID | 6480554 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine |
| SMILES | CC(C)=CCC[C@@H](C)CCNCCC1CCCN1C |
| InChI | InChI=1S/C17H34N2/c1-15(2)7-5-8-16(3)10-12-18-13-11-17-9-6-14-19(17)4/h7,16-18H,5-6,8-14H2,1-4H3/t16-,17?/m1/s1 |
| InChIKey | XKDSGJMRBCKWSX-TZHYSIJRSA-N |
| XLogP | 3.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine?
The IUPAC name of (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine (CID 6480554) is (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine.
What is the SMILES notation for (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine?
The canonical SMILES for (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine is CC(C)=CCC[C@@H](C)CCNCCC1CCCN1C.
What is the InChIKey of (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine?
The InChIKey is XKDSGJMRBCKWSX-TZHYSIJRSA-N. The full InChI is InChI=1S/C17H34N2/c1-15(2)7-5-8-16(3)10-12-18-13-11-17-9-6-14-19(17)4/h7,16-18H,5-6,8-14H2,1-4H3/t16-,17?/m1/s1.
What are the key properties of (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine?
(3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine has a molecular weight of 266.47 g/mol, XLogP of 3.83, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,7-dimethyl-N-[2-(1-methylpyrrolidin-2-yl)ethyl]oct-6-en-1-amine is sourced from PubChem (CID 6480554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).