C15H20FNOS — CID 64805552
2-cyclopropyl-2-(cyclopropylamino)-3-(4-fluorophenyl)sulfanylpropan-1-ol (PubChem CID 64805552) has the molecular formula C15H20FNOS and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-cyclopropyl-2-(cyclopropylamino)-3-(4-fluorophenyl)sulfanylpropan-1-ol.
| Compound Name | 2-cyclopropyl-2-(cyclopropylamino)-3-(4-fluorophenyl)sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 64805552 |
| Molecular Formula | C15H20FNOS |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-cyclopropyl-2-(cyclopropylamino)-3-(4-fluorophenyl)sulfanylpropan-1-ol |
| SMILES | OCC(CSc1ccc(F)cc1)(NC1CC1)C1CC1 |
| InChI | InChI=1S/C15H20FNOS/c16-12-3-7-14(8-4-12)19-10-15(9-18,11-1-2-11)17-13-5-6-13/h3-4,7-8,11,13,17-18H,1-2,5-6,9-10H2 |
| InChIKey | GGFGMQVWQWNLIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |