About 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine
4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine (PubChem CID 6480564) has the molecular formula C23H44N2
and a molecular weight of 348.62 g/mol. Its IUPAC name is 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine |
| PubChem CID | 6480564 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine |
| SMILES | CC(C)=CCC[C@H](C)CCNC1CCC(CC2CCC(N)CC2)CC1 |
| InChI | InChI=1S/C23H44N2/c1-18(2)5-4-6-19(3)15-16-25-23-13-9-21(10-14-23)17-20-7-11-22(24)12-8-20/h5,19-23,25H,4,6-17,24H2,1-3H3/t19-,20?,21?,22?,23?/m0/s1 |
| InChIKey | NRZINCYUQNNQLR-PTLIKGBSSA-N |
| XLogP | 5.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine?
The IUPAC name of 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine (CID 6480564) is 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine.
What is the SMILES notation for 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine?
The canonical SMILES for 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine is CC(C)=CCC[C@H](C)CCNC1CCC(CC2CCC(N)CC2)CC1.
What is the InChIKey of 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine?
The InChIKey is NRZINCYUQNNQLR-PTLIKGBSSA-N. The full InChI is InChI=1S/C23H44N2/c1-18(2)5-4-6-19(3)15-16-25-23-13-9-21(10-14-23)17-20-7-11-22(24)12-8-20/h5,19-23,25H,4,6-17,24H2,1-3H3/t19-,20?,21?,22?,23?/m0/s1.
What are the key properties of 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine?
4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine has a molecular weight of 348.62 g/mol, XLogP of 5.82, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[[(3S)-3,7-dimethyloct-6-enyl]amino]cyclohexyl]methyl]cyclohexan-1-amine is sourced from PubChem (CID 6480564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).