C14H26N4OS — CID 64805705
2-(cyclopropylamino)-6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methylhexan-1-ol (PubChem CID 64805705) has the molecular formula C14H26N4OS and a molecular weight of 298.46 g/mol. Its IUPAC name is 2-(cyclopropylamino)-6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methylhexan-1-ol.
| Compound Name | 2-(cyclopropylamino)-6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methylhexan-1-ol |
|---|---|
| PubChem CID | 64805705 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-(cyclopropylamino)-6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methylhexan-1-ol |
| SMILES | Cc1nnc(SCCCCC(C)(CO)NC2CC2)n1C |
| InChI | InChI=1S/C14H26N4OS/c1-11-16-17-13(18(11)3)20-9-5-4-8-14(2,10-19)15-12-6-7-12/h12,15,19H,4-10H2,1-3H3 |
| InChIKey | ZCYVWNIDJYPIQE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|