C13H16F5NO2 — CID 64806058
4-(2,3,4,5,6-pentafluorophenoxy)-2-(propylamino)butan-1-ol (PubChem CID 64806058) has the molecular formula C13H16F5NO2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenoxy)-2-(propylamino)butan-1-ol.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenoxy)-2-(propylamino)butan-1-ol |
|---|---|
| PubChem CID | 64806058 |
| Molecular Formula | C13H16F5NO2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenoxy)-2-(propylamino)butan-1-ol |
| SMILES | CCCNC(CO)CCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H16F5NO2/c1-2-4-19-7(6-20)3-5-21-13-11(17)9(15)8(14)10(16)12(13)18/h7,19-20H,2-6H2,1H3 |
| InChIKey | CBSDBMPPPGPCDN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|