About 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol
2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol (PubChem CID 64806141) has the molecular formula C9H18N4OS
and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol.
Molecular Properties
| Compound Name | 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol |
| PubChem CID | 64806141 |
| Molecular Formula | C9H18N4OS |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol |
| SMILES | CCCNC(CO)CCSc1ncn[nH]1 |
| InChI | InChI=1S/C9H18N4OS/c1-2-4-10-8(6-14)3-5-15-9-11-7-12-13-9/h7-8,10,14H,2-6H2,1H3,(H,11,12,13) |
| InChIKey | QSJOHJIJVNKVRJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol?
The IUPAC name of 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol (CID 64806141) is 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol.
What is the SMILES notation for 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol?
The canonical SMILES for 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol is CCCNC(CO)CCSc1ncn[nH]1.
What is the InChIKey of 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol?
The InChIKey is QSJOHJIJVNKVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4OS/c1-2-4-10-8(6-14)3-5-15-9-11-7-12-13-9/h7-8,10,14H,2-6H2,1H3,(H,11,12,13).
What are the key properties of 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol?
2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol has a molecular weight of 230.34 g/mol, XLogP of 0.65, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylamino)-4-(1H-1,2,4-triazol-5-ylsulfanyl)butan-1-ol is sourced from PubChem (CID 64806141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).