About 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol
2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol (PubChem CID 64806189) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol.
Molecular Properties
| Compound Name | 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol |
| PubChem CID | 64806189 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol |
| SMILES | Cn1cnnc1SCC(N)(CO)c1ccccc1 |
| InChI | InChI=1S/C12H16N4OS/c1-16-9-14-15-11(16)18-8-12(13,7-17)10-5-3-2-4-6-10/h2-6,9,17H,7-8,13H2,1H3 |
| InChIKey | QNUWRPAMGVMMRA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol?
The IUPAC name of 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol (CID 64806189) is 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol.
What is the SMILES notation for 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol?
The canonical SMILES for 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol is Cn1cnnc1SCC(N)(CO)c1ccccc1.
What is the InChIKey of 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol?
The InChIKey is QNUWRPAMGVMMRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4OS/c1-16-9-14-15-11(16)18-8-12(13,7-17)10-5-3-2-4-6-10/h2-6,9,17H,7-8,13H2,1H3.
What are the key properties of 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol?
2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol has a molecular weight of 264.35 g/mol, XLogP of 0.75, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-phenylpropan-1-ol is sourced from PubChem (CID 64806189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).