C19H38N2 — CID 6480625
N-[(3R)-3,7-dimethyloct-6-enyl]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 6480625) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is N-[(3R)-3,7-dimethyloct-6-enyl]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-[(3R)-3,7-dimethyloct-6-enyl]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 6480625 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | N-[(3R)-3,7-dimethyloct-6-enyl]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CC(C)=CCC[C@@H](C)CCNC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C19H38N2/c1-15(2)9-8-10-16(3)11-12-20-17-13-18(4,5)21-19(6,7)14-17/h9,16-17,20-21H,8,10-14H2,1-7H3/t16-/m1/s1 |
| InChIKey | JEDFQOBJLTYPSS-MRXNPFEDSA-N |
| XLogP | 4.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|