C45H84O6 — CID 6480643
(6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,10,34-tetraene-3,15,19,23,27,31-hexol (PubChem CID 6480643) has the molecular formula C45H84O6 and a molecular weight of 721.16 g/mol. Its IUPAC name is (6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,10,34-tetraene-3,15,19,23,27,31-hexol.
| Compound Name | (6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,10,34-tetraene-3,15,19,23,27,31-hexol |
|---|---|
| PubChem CID | 6480643 |
| Molecular Formula | C45H84O6 |
| Molecular Weight | 721.16 g/mol |
| Exact Mass | 720.63 |
| IUPAC Name | (6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,10,34-tetraene-3,15,19,23,27,31-hexol |
| SMILES | C=CC(C)(O)CC/C=C(\C)CC/C=C(\C)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C45H84O6/c1-12-40(6,46)26-15-24-38(4)22-13-23-39(5)25-16-28-42(8,48)30-18-32-44(10,50)34-20-36-45(11,51)35-19-33-43(9,49)31-17-29-41(7,47)27-14-21-37(2)3/h12,21,23-24,46-51H,1,13-20,22,25-36H2,2-11H3/b38-24+,39-23+ |
| InChIKey | DGMDXWIMXBSSCY-RIZDTFTOSA-N |
| XLogP | 10.73 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.16 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|