C45H86O8 — CID 6480644
(6E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,34-triene-3,10,11,15,19,23,27,31-octol (PubChem CID 6480644) has the molecular formula C45H86O8 and a molecular weight of 755.17 g/mol. Its IUPAC name is (6E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,34-triene-3,10,11,15,19,23,27,31-octol.
| Compound Name | (6E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,34-triene-3,10,11,15,19,23,27,31-octol |
|---|---|
| PubChem CID | 6480644 |
| Molecular Formula | C45H86O8 |
| Molecular Weight | 755.17 g/mol |
| Exact Mass | 754.63 |
| IUPAC Name | (6E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-1,6,34-triene-3,10,11,15,19,23,27,31-octol |
| SMILES | C=CC(C)(O)CC/C=C(\C)CCC(O)C(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C45H86O8/c1-12-39(5,47)24-14-21-37(4)22-23-38(46)45(11,53)35-19-34-44(10,52)33-18-32-43(9,51)31-17-30-42(8,50)29-16-28-41(7,49)27-15-26-40(6,48)25-13-20-36(2)3/h12,20-21,38,46-53H,1,13-19,22-35H2,2-11H3/b37-21+ |
| InChIKey | YOGIROLNHNFOFV-FDALDRLYSA-N |
| XLogP | 8.89 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.17 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|