C50H94O7 — CID 6480645
(6E,10E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-1,6,10,38-tetraene-3,15,19,23,27,31,35-heptol (PubChem CID 6480645) has the molecular formula C50H94O7 and a molecular weight of 807.29 g/mol. Its IUPAC name is (6E,10E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-1,6,10,38-tetraene-3,15,19,23,27,31,35-heptol.
| Compound Name | (6E,10E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-1,6,10,38-tetraene-3,15,19,23,27,31,35-heptol |
|---|---|
| PubChem CID | 6480645 |
| Molecular Formula | C50H94O7 |
| Molecular Weight | 807.29 g/mol |
| Exact Mass | 806.70 |
| IUPAC Name | (6E,10E)-3,7,11,15,19,23,27,31,35,39-decamethyltetraconta-1,6,10,38-tetraene-3,15,19,23,27,31,35-heptol |
| SMILES | C=CC(C)(O)CC/C=C(\C)CC/C=C(\C)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C50H94O7/c1-13-44(6,51)28-16-26-42(4)24-14-25-43(5)27-17-30-46(8,53)32-19-34-48(10,55)36-21-38-50(12,57)40-22-39-49(11,56)37-20-35-47(9,54)33-18-31-45(7,52)29-15-23-41(2)3/h13,23,25-26,51-57H,1,14-22,24,27-40H2,2-12H3/b42-26+,43-25+ |
| InChIKey | PGKWOUQKDDYJEI-AUNPKQNBSA-N |
| XLogP | 11.65 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.29 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|