C17H29NO2 — CID 64806675
3-(3-tert-butylphenoxy)-2-methyl-2-(propylamino)propan-1-ol (PubChem CID 64806675) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 3-(3-tert-butylphenoxy)-2-methyl-2-(propylamino)propan-1-ol.
| Compound Name | 3-(3-tert-butylphenoxy)-2-methyl-2-(propylamino)propan-1-ol |
|---|---|
| PubChem CID | 64806675 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 3-(3-tert-butylphenoxy)-2-methyl-2-(propylamino)propan-1-ol |
| SMILES | CCCNC(C)(CO)COc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H29NO2/c1-6-10-18-17(5,12-19)13-20-15-9-7-8-14(11-15)16(2,3)4/h7-9,11,18-19H,6,10,12-13H2,1-5H3 |
| InChIKey | ZVGBXCBEEOTLEO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |