C16H19N3OS — CID 64806755
2-(cyclopropylamino)-2-phenyl-3-pyrimidin-4-ylsulfanylpropan-1-ol (PubChem CID 64806755) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-phenyl-3-pyrimidin-4-ylsulfanylpropan-1-ol.
| Compound Name | 2-(cyclopropylamino)-2-phenyl-3-pyrimidin-4-ylsulfanylpropan-1-ol |
|---|---|
| PubChem CID | 64806755 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-(cyclopropylamino)-2-phenyl-3-pyrimidin-4-ylsulfanylpropan-1-ol |
| SMILES | OCC(CSc1ccncn1)(NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C16H19N3OS/c20-10-16(19-14-6-7-14,13-4-2-1-3-5-13)11-21-15-8-9-17-12-18-15/h1-5,8-9,12,14,19-20H,6-7,10-11H2 |
| InChIKey | KUDNMWGNRSBQPN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |