methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate

C16H11NO4S — CID 6480725

IUPACmethyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate
SMILESCOC(=O)c1cc2c(s1)C(=O)C=C(Nc1ccccc1)C2=O
InChIInChI=1S/C16H11NO4S/c1-21-16(20)13-7-10-14(19)11(8-12(18)15(10)22-13)17-9-5-3-2-4-6-9/h2-8,17H,1H3
InChIKeyZWNVODQVXCRNRF-UHFFFAOYSA-N
MW313.33 g/mol
LogP2.91
Rot. Bonds3

About methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate

methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate (PubChem CID 6480725) has the molecular formula C16H11NO4S and a molecular weight of 313.33 g/mol. Its IUPAC name is methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate
PubChem CID6480725
Molecular FormulaC16H11NO4S
Molecular Weight313.33 g/mol
Exact Mass313.04
IUPAC Namemethyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate
SMILESCOC(=O)c1cc2c(s1)C(=O)C=C(Nc1ccccc1)C2=O
InChIInChI=1S/C16H11NO4S/c1-21-16(20)13-7-10-14(19)11(8-12(18)15(10)22-13)17-9-5-3-2-4-6-9/h2-8,17H,1H3
InChIKeyZWNVODQVXCRNRF-UHFFFAOYSA-N
XLogP2.91
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.33
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}

Analyze methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate?
The IUPAC name of methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate (CID 6480725) is methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate.
What is the SMILES notation for methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate?
The canonical SMILES for methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate is COC(=O)c1cc2c(s1)C(=O)C=C(Nc1ccccc1)C2=O.
What is the InChIKey of methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate?
The InChIKey is ZWNVODQVXCRNRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO4S/c1-21-16(20)13-7-10-14(19)11(8-12(18)15(10)22-13)17-9-5-3-2-4-6-9/h2-8,17H,1H3.
What are the key properties of methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate?
methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate has a molecular weight of 313.33 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-anilino-4,7-dioxo-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 6480725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).