About methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate
methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate (PubChem CID 6480730) has the molecular formula C17H13NO4S
and a molecular weight of 327.36 g/mol. Its IUPAC name is methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate |
| PubChem CID | 6480730 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)C(=O)C=C(Nc1ccc(C)cc1)C2=O |
| InChI | InChI=1S/C17H13NO4S/c1-9-3-5-10(6-4-9)18-12-8-13(19)16-11(15(12)20)7-14(23-16)17(21)22-2/h3-8,18H,1-2H3 |
| InChIKey | SFMONESJDGWRSO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate?
The IUPAC name of methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate (CID 6480730) is methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate.
What is the SMILES notation for methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate?
The canonical SMILES for methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate is COC(=O)c1cc2c(s1)C(=O)C=C(Nc1ccc(C)cc1)C2=O.
What is the InChIKey of methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate?
The InChIKey is SFMONESJDGWRSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO4S/c1-9-3-5-10(6-4-9)18-12-8-13(19)16-11(15(12)20)7-14(23-16)17(21)22-2/h3-8,18H,1-2H3.
What are the key properties of methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate?
methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate has a molecular weight of 327.36 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-methylanilino)-4,7-dioxo-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 6480730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).