C14H23N3OS — CID 64807747
2-(cyclopropylamino)-2-methyl-4-(4-methylpyrimidin-2-yl)sulfanylpentan-1-ol (PubChem CID 64807747) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-methyl-4-(4-methylpyrimidin-2-yl)sulfanylpentan-1-ol.
| Compound Name | 2-(cyclopropylamino)-2-methyl-4-(4-methylpyrimidin-2-yl)sulfanylpentan-1-ol |
|---|---|
| PubChem CID | 64807747 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(cyclopropylamino)-2-methyl-4-(4-methylpyrimidin-2-yl)sulfanylpentan-1-ol |
| SMILES | Cc1ccnc(SC(C)CC(C)(CO)NC2CC2)n1 |
| InChI | InChI=1S/C14H23N3OS/c1-10-6-7-15-13(16-10)19-11(2)8-14(3,9-18)17-12-4-5-12/h6-7,11-12,17-18H,4-5,8-9H2,1-3H3 |
| InChIKey | CJISMLLUNXEMIE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |