C17H33NO2 — CID 64808158
2-(cyclopropylamino)-5-(3,5-dimethylcyclohexyl)oxy-2-methylpentan-1-ol (PubChem CID 64808158) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-(cyclopropylamino)-5-(3,5-dimethylcyclohexyl)oxy-2-methylpentan-1-ol.
| Compound Name | 2-(cyclopropylamino)-5-(3,5-dimethylcyclohexyl)oxy-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 64808158 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 2-(cyclopropylamino)-5-(3,5-dimethylcyclohexyl)oxy-2-methylpentan-1-ol |
| SMILES | CC1CC(C)CC(OCCCC(C)(CO)NC2CC2)C1 |
| InChI | InChI=1S/C17H33NO2/c1-13-9-14(2)11-16(10-13)20-8-4-7-17(3,12-19)18-15-5-6-15/h13-16,18-19H,4-12H2,1-3H3 |
| InChIKey | YDYIRLLYYZQFKV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|