About 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol
2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol (PubChem CID 64808598) has the molecular formula C13H21N3OS
and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol.
Molecular Properties
| Compound Name | 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol |
| PubChem CID | 64808598 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol |
| SMILES | CNC(CO)(CSc1nc(C)cc(C)n1)C1CC1 |
| InChI | InChI=1S/C13H21N3OS/c1-9-6-10(2)16-12(15-9)18-8-13(7-17,14-3)11-4-5-11/h6,11,14,17H,4-5,7-8H2,1-3H3 |
| InChIKey | XQZAVSQMMCHDES-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol?
The IUPAC name of 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol (CID 64808598) is 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol.
What is the SMILES notation for 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol?
The canonical SMILES for 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol is CNC(CO)(CSc1nc(C)cc(C)n1)C1CC1.
What is the InChIKey of 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol?
The InChIKey is XQZAVSQMMCHDES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3OS/c1-9-6-10(2)16-12(15-9)18-8-13(7-17,14-3)11-4-5-11/h6,11,14,17H,4-5,7-8H2,1-3H3.
What are the key properties of 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol?
2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol has a molecular weight of 267.40 g/mol, XLogP of 1.55, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-(methylamino)propan-1-ol is sourced from PubChem (CID 64808598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).