C26H37N7O2 — CID 648087
3-[(1-cyclohexyltetrazol-5-yl)-(4-propylpiperazin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one (PubChem CID 648087) has the molecular formula C26H37N7O2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 3-[(1-cyclohexyltetrazol-5-yl)-(4-propylpiperazin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one.
| Compound Name | 3-[(1-cyclohexyltetrazol-5-yl)-(4-propylpiperazin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 648087 |
| Molecular Formula | C26H37N7O2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | 3-[(1-cyclohexyltetrazol-5-yl)-(4-propylpiperazin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one |
| SMILES | CCCN1CCN(C(c2cc3cc(OCC)ccc3[nH]c2=O)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H37N7O2/c1-3-12-31-13-15-32(16-14-31)24(25-28-29-30-33(25)20-8-6-5-7-9-20)22-18-19-17-21(35-4-2)10-11-23(19)27-26(22)34/h10-11,17-18,20,24H,3-9,12-16H2,1-2H3,(H,27,34) |
| InChIKey | KMZXNCIZLHFHSS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |