C13H26N4O — CID 64808836
6-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-(ethylamino)-2-methylhexan-1-ol (PubChem CID 64808836) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is 6-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-(ethylamino)-2-methylhexan-1-ol.
| Compound Name | 6-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-(ethylamino)-2-methylhexan-1-ol |
|---|---|
| PubChem CID | 64808836 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 6-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-(ethylamino)-2-methylhexan-1-ol |
| SMILES | CCNC(C)(CO)CCCCn1nc(C)nc1C |
| InChI | InChI=1S/C13H26N4O/c1-5-14-13(4,10-18)8-6-7-9-17-12(3)15-11(2)16-17/h14,18H,5-10H2,1-4H3 |
| InChIKey | FIONRTHRJGAESI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|