C11H21N3O — CID 64810250
2-(ethylamino)-3-(2-propylimidazol-1-yl)propan-1-ol (PubChem CID 64810250) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-(ethylamino)-3-(2-propylimidazol-1-yl)propan-1-ol.
| Compound Name | 2-(ethylamino)-3-(2-propylimidazol-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 64810250 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2-(ethylamino)-3-(2-propylimidazol-1-yl)propan-1-ol |
| SMILES | CCCc1nccn1CC(CO)NCC |
| InChI | InChI=1S/C11H21N3O/c1-3-5-11-13-6-7-14(11)8-10(9-15)12-4-2/h6-7,10,12,15H,3-5,8-9H2,1-2H3 |
| InChIKey | FPGOMHPCXVQRDG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |