C23H26N2OS — CID 6481061
(4Z)-1-benzyl-4-(3-butyl-1,3-benzothiazol-2-ylidene)piperidin-3-one (PubChem CID 6481061) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is (4Z)-1-benzyl-4-(3-butyl-1,3-benzothiazol-2-ylidene)piperidin-3-one.
| Compound Name | (4Z)-1-benzyl-4-(3-butyl-1,3-benzothiazol-2-ylidene)piperidin-3-one |
|---|---|
| PubChem CID | 6481061 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (4Z)-1-benzyl-4-(3-butyl-1,3-benzothiazol-2-ylidene)piperidin-3-one |
| SMILES | CCCCN1/C(=C2\CCN(Cc3ccccc3)CC2=O)Sc2ccccc21 |
| InChI | InChI=1S/C23H26N2OS/c1-2-3-14-25-20-11-7-8-12-22(20)27-23(25)19-13-15-24(17-21(19)26)16-18-9-5-4-6-10-18/h4-12H,2-3,13-17H2,1H3/b23-19- |
| InChIKey | DXFPIWJKBJZKOO-NMWGTECJSA-N |
| XLogP | 5.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|