About 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid
5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid (PubChem CID 6481085) has the molecular formula C17H17BrN4O3
and a molecular weight of 405.25 g/mol. Its IUPAC name is 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid.
Molecular Properties
| Compound Name | 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid |
| PubChem CID | 6481085 |
| Molecular Formula | C17H17BrN4O3 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(C#CCCC(=O)O)c1Br |
| InChI | InChI=1S/C17H17BrN4O3/c1-25-13-8-10(7-12-9-21-17(20)22-16(12)19)6-11(15(13)18)4-2-3-5-14(23)24/h6,8-9H,3,5,7H2,1H3,(H,23,24)(H4,19,20,21,22) |
| InChIKey | DWQGRIVGUVJVRF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid?
The IUPAC name of 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid (CID 6481085) is 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid.
What is the SMILES notation for 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid?
The canonical SMILES for 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid is COc1cc(Cc2cnc(N)nc2N)cc(C#CCCC(=O)O)c1Br.
What is the InChIKey of 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid?
The InChIKey is DWQGRIVGUVJVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN4O3/c1-25-13-8-10(7-12-9-21-17(20)22-16(12)19)6-11(15(13)18)4-2-3-5-14(23)24/h6,8-9H,3,5,7H2,1H3,(H,23,24)(H4,19,20,21,22).
What are the key properties of 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid?
5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid has a molecular weight of 405.25 g/mol, XLogP of 2.22, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-bromo-5-[(2,4-diaminopyrimidin-5-yl)methyl]-3-methoxyphenyl]pent-4-ynoic acid is sourced from PubChem (CID 6481085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).