C16H16IN5O — CID 6481091
6-[(5-iodo-2-methoxyphenyl)methyl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 6481091) has the molecular formula C16H16IN5O and a molecular weight of 421.24 g/mol. Its IUPAC name is 6-[(5-iodo-2-methoxyphenyl)methyl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 6-[(5-iodo-2-methoxyphenyl)methyl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 6481091 |
| Molecular Formula | C16H16IN5O |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 6-[(5-iodo-2-methoxyphenyl)methyl]-5-methylpyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(I)cc1Cc1cnc2nc(N)nc(N)c2c1C |
| InChI | InChI=1S/C16H16IN5O/c1-8-10(5-9-6-11(17)3-4-12(9)23-2)7-20-15-13(8)14(18)21-16(19)22-15/h3-4,6-7H,5H2,1-2H3,(H4,18,19,20,21,22) |
| InChIKey | CFTCUSCIZZTKPF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|