C15H20O — CID 6481133
(2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaenal (PubChem CID 6481133) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaenal.
| Compound Name | (2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaenal |
|---|---|
| PubChem CID | 6481133 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2E,4E,6E,8E)-3,7,11-trimethyldodeca-2,4,6,8,10-pentaenal |
| SMILES | CC(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=O |
| InChI | InChI=1S/C15H20O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h5-12H,1-4H3/b8-5+,10-6+,14-9+,15-11+ |
| InChIKey | WWRGFLIMFQYXRS-BZCYSDSTSA-N |
| XLogP | 4.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|